C17H36O6 — CID 175356335
1-(2-butoxyethoxy)-2,2,2-tri(propan-2-yloxy)ethanol (PubChem CID 175356335) has the molecular formula C17H36O6 and a molecular weight of 336.47 g/mol. Its IUPAC name is 1-(2-butoxyethoxy)-2,2,2-tri(propan-2-yloxy)ethanol.
| Compound Name | 1-(2-butoxyethoxy)-2,2,2-tri(propan-2-yloxy)ethanol |
|---|---|
| PubChem CID | 175356335 |
| Molecular Formula | C17H36O6 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-(2-butoxyethoxy)-2,2,2-tri(propan-2-yloxy)ethanol |
| SMILES | CCCCOCCOC(O)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C17H36O6/c1-8-9-10-19-11-12-20-16(18)17(21-13(2)3,22-14(4)5)23-15(6)7/h13-16,18H,8-12H2,1-7H3 |
| InChIKey | NEIYLFAEOXPTGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|