C9H15F3N2 — CID 175356791
3-ethyl-4-N,5,5-trifluoroheptane-2,4-diimine (PubChem CID 175356791) has the molecular formula C9H15F3N2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 3-ethyl-4-N,5,5-trifluoroheptane-2,4-diimine.
| Compound Name | 3-ethyl-4-N,5,5-trifluoroheptane-2,4-diimine |
|---|---|
| PubChem CID | 175356791 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3-ethyl-4-N,5,5-trifluoroheptane-2,4-diimine |
| SMILES | [H]/N=C(\C)C(CC)C(=NF)C(F)(F)CC |
| InChI | InChI=1S/C9H15F3N2/c1-4-7(6(3)13)8(14-12)9(10,11)5-2/h7,13H,4-5H2,1-3H3/b13-6+,14-8? |
| InChIKey | NBDHDFQKWOBHJI-HAVDUTDFSA-N |
| XLogP | 3.42 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|