C22H21BrF3N5O4 — CID 175357093
2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-N-(1,2,2-trifluoroethyl)benzamide (PubChem CID 175357093) has the molecular formula C22H21BrF3N5O4 and a molecular weight of 556.34 g/mol. Its IUPAC name is 2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-N-(1,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-N-(1,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 175357093 |
| Molecular Formula | C22H21BrF3N5O4 |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | 2-[[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]-N-(1,2,2-trifluoroethyl)benzamide |
| SMILES | COc1cc(Nc2ncc(Br)c(Nc3ccccc3C(=O)NC(F)C(F)F)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21BrF3N5O4/c1-33-15-8-11(9-16(34-2)17(15)35-3)28-22-27-10-13(23)20(31-22)29-14-7-5-4-6-12(14)21(32)30-19(26)18(24)25/h4-10,18-19H,1-3H3,(H,30,32)(H2,27,28,29,31) |
| InChIKey | JIEKNJGKCPRBCW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|