C15H18O6 — CID 175357247
benzene-1,2,3-triol;[3,5-bis(hydroxymethyl)phenyl]methanol (PubChem CID 175357247) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is benzene-1,2,3-triol;[3,5-bis(hydroxymethyl)phenyl]methanol.
| Compound Name | benzene-1,2,3-triol;[3,5-bis(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 175357247 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | benzene-1,2,3-triol;[3,5-bis(hydroxymethyl)phenyl]methanol |
| SMILES | OCc1cc(CO)cc(CO)c1.Oc1cccc(O)c1O |
| InChI | InChI=1S/C9H12O3.C6H6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12;7-4-2-1-3-5(8)6(4)9/h1-3,10-12H,4-6H2;1-3,7-9H |
| InChIKey | IBXZEASYHBENIP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|