About (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid
(4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid (PubChem CID 175357745) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid.
Molecular Properties
| Compound Name | (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid |
| PubChem CID | 175357745 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid |
| SMILES | CCC(C)(CC)N(C(=O)O)C(C)(CC)C(C)(CC)CC |
| InChI | InChI=1S/C17H35NO2/c1-9-15(6,10-2)17(8,13-5)18(14(19)20)16(7,11-3)12-4/h9-13H2,1-8H3,(H,19,20) |
| InChIKey | WMGFAOHODCWULC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid?
The IUPAC name of (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid (CID 175357745) is (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid.
What is the SMILES notation for (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid?
The canonical SMILES for (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid is CCC(C)(CC)N(C(=O)O)C(C)(CC)C(C)(CC)CC.
What is the InChIKey of (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid?
The InChIKey is WMGFAOHODCWULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-9-15(6,10-2)17(8,13-5)18(14(19)20)16(7,11-3)12-4/h9-13H2,1-8H3,(H,19,20).
What are the key properties of (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid?
(4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid has a molecular weight of 285.47 g/mol, XLogP of 5.54, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-3,4-dimethylhexan-3-yl)-(3-methylpentan-3-yl)carbamic acid is sourced from PubChem (CID 175357745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).