About [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate
[6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate (PubChem CID 175357818) has the molecular formula C22H19FN4O3
and a molecular weight of 406.42 g/mol. Its IUPAC name is [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate.
Molecular Properties
| Compound Name | [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate |
| PubChem CID | 175357818 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate |
| SMILES | NC(=O)Oc1cc(Nc2ccccc2F)cc(C(=O)NC2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C22H19FN4O3/c23-17-7-3-4-8-18(17)25-16-11-19(27-20(12-16)30-22(24)29)21(28)26-15-9-13-5-1-2-6-14(13)10-15/h1-8,11-12,15H,9-10H2,(H2,24,29)(H,25,27)(H,26,28) |
| InChIKey | JHKVHBOGTPXSOP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate?
The IUPAC name of [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate (CID 175357818) is [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate.
What is the SMILES notation for [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate?
The canonical SMILES for [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate is NC(=O)Oc1cc(Nc2ccccc2F)cc(C(=O)NC2Cc3ccccc3C2)n1.
What is the InChIKey of [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate?
The InChIKey is JHKVHBOGTPXSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN4O3/c23-17-7-3-4-8-18(17)25-16-11-19(27-20(12-16)30-22(24)29)21(28)26-15-9-13-5-1-2-6-14(13)10-15/h1-8,11-12,15H,9-10H2,(H2,24,29)(H,25,27)(H,26,28).
What are the key properties of [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate?
[6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate has a molecular weight of 406.42 g/mol, XLogP of 3.32, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,3-dihydro-1H-inden-2-ylcarbamoyl)-4-(2-fluoroanilino)-2-pyridinyl] carbamate is sourced from PubChem (CID 175357818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).