About sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid
sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid (PubChem CID 175357894) has the molecular formula C10H21NaO4S
and a molecular weight of 260.33 g/mol. Its IUPAC name is sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid.
Molecular Properties
| Compound Name | sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid |
| PubChem CID | 175357894 |
| Molecular Formula | C10H21NaO4S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid |
| SMILES | CC(C)=CCCC(C)CC(O)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C10H20O4S.Na.H/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;;/h5,9-11H,4,6-7H2,1-3H3,(H,12,13,14);;/q;+1;-1 |
| InChIKey | RHAZQJCEWBFWDB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid?
The IUPAC name of sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid (CID 175357894) is sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid.
What is the SMILES notation for sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid?
The canonical SMILES for sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid is CC(C)=CCCC(C)CC(O)S(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid?
The InChIKey is RHAZQJCEWBFWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4S.Na.H/c1-8(2)5-4-6-9(3)7-10(11)15(12,13)14;;/h5,9-11H,4,6-7H2,1-3H3,(H,12,13,14);;/q;+1;-1.
What are the key properties of sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid?
sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid has a molecular weight of 260.33 g/mol, XLogP of -0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1-hydroxy-3,7-dimethyloct-6-ene-1-sulfonic acid is sourced from PubChem (CID 175357894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).