About benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate
benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 175357947) has the molecular formula C21H25NO5S
and a molecular weight of 403.50 g/mol. Its IUPAC name is benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| PubChem CID | 175357947 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc(C2COC(C)(C)N2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-4-28(24,25)18-12-10-17(11-13-18)19-15-27-21(2,3)22(19)20(23)26-14-16-8-6-5-7-9-16/h5-13,19H,4,14-15H2,1-3H3 |
| InChIKey | LRTCTTZGOUXBOO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The IUPAC name of benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (CID 175357947) is benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
What is the SMILES notation for benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The canonical SMILES for benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate is CCS(=O)(=O)c1ccc(C2COC(C)(C)N2C(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
The InChIKey is LRTCTTZGOUXBOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO5S/c1-4-28(24,25)18-12-10-17(11-13-18)19-15-27-21(2,3)22(19)20(23)26-14-16-8-6-5-7-9-16/h5-13,19H,4,14-15H2,1-3H3.
What are the key properties of benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate?
benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate has a molecular weight of 403.50 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(4-ethylsulfonylphenyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate is sourced from PubChem (CID 175357947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).