C7H4F12 — CID 175358537
1,1,1,2,3,3,4,4,5,7,7,7-dodecafluoroheptane (PubChem CID 175358537) has the molecular formula C7H4F12 and a molecular weight of 316.09 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,4,5,7,7,7-dodecafluoroheptane.
| Compound Name | 1,1,1,2,3,3,4,4,5,7,7,7-dodecafluoroheptane |
|---|---|
| PubChem CID | 175358537 |
| Molecular Formula | C7H4F12 |
| Molecular Weight | 316.09 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1,1,1,2,3,3,4,4,5,7,7,7-dodecafluoroheptane |
| SMILES | FC(CC(F)(F)F)C(F)(F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12/c8-2(1-4(10,11)12)5(13,14)6(15,16)3(9)7(17,18)19/h2-3H,1H2 |
| InChIKey | KIUGMPHGCXKCGS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|