C23H16O8 — CID 175358627
2,8-dioxo-10-(4-propan-2-ylphenyl)pyrano[2,3-f]chromene-3,9-dicarboxylic acid (PubChem CID 175358627) has the molecular formula C23H16O8 and a molecular weight of 420.37 g/mol. Its IUPAC name is 2,8-dioxo-10-(4-propan-2-ylphenyl)pyrano[2,3-f]chromene-3,9-dicarboxylic acid.
| Compound Name | 2,8-dioxo-10-(4-propan-2-ylphenyl)pyrano[2,3-f]chromene-3,9-dicarboxylic acid |
|---|---|
| PubChem CID | 175358627 |
| Molecular Formula | C23H16O8 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2,8-dioxo-10-(4-propan-2-ylphenyl)pyrano[2,3-f]chromene-3,9-dicarboxylic acid |
| SMILES | CC(C)c1ccc(-c2c(C(=O)O)c(=O)oc3ccc4cc(C(=O)O)c(=O)oc4c23)cc1 |
| InChI | InChI=1S/C23H16O8/c1-10(2)11-3-5-12(6-4-11)16-17-15(30-23(29)18(16)21(26)27)8-7-13-9-14(20(24)25)22(28)31-19(13)17/h3-10H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | NBEPCMBLLAVOPB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|