C9H11F3N2O — CID 175358714
1,2,2-trifluoro-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 175358714) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 1,2,2-trifluoro-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | 1,2,2-trifluoro-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 175358714 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,2,2-trifluoro-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | COc1ccc(CNC(F)C(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O/c1-15-7-3-2-6(4-13-7)5-14-9(12)8(10)11/h2-4,8-9,14H,5H2,1H3 |
| InChIKey | NVOSUDPNBBYGAH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|