About oct-1-ene;piperazine;silane
oct-1-ene;piperazine;silane (PubChem CID 175359517) has the molecular formula C12H30N2Si
and a molecular weight of 230.47 g/mol. Its IUPAC name is oct-1-ene;piperazine;silane.
Molecular Properties
| Compound Name | oct-1-ene;piperazine;silane |
| PubChem CID | 175359517 |
| Molecular Formula | C12H30N2Si |
| Molecular Weight | 230.47 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | oct-1-ene;piperazine;silane |
| SMILES | C1CNCCN1.C=CCCCCCC.[SiH4] |
| InChI | InChI=1S/C8H16.C4H10N2.H4Si/c1-3-5-7-8-6-4-2;1-2-6-4-3-5-1;/h3H,1,4-8H2,2H3;5-6H,1-4H2;1H4 |
| InChIKey | KGRVBQPNXHHENF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze oct-1-ene;piperazine;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-1-ene;piperazine;silane?
The IUPAC name of oct-1-ene;piperazine;silane (CID 175359517) is oct-1-ene;piperazine;silane.
What is the SMILES notation for oct-1-ene;piperazine;silane?
The canonical SMILES for oct-1-ene;piperazine;silane is C1CNCCN1.C=CCCCCCC.[SiH4].
What is the InChIKey of oct-1-ene;piperazine;silane?
The InChIKey is KGRVBQPNXHHENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C4H10N2.H4Si/c1-3-5-7-8-6-4-2;1-2-6-4-3-5-1;/h3H,1,4-8H2,2H3;5-6H,1-4H2;1H4.
What are the key properties of oct-1-ene;piperazine;silane?
oct-1-ene;piperazine;silane has a molecular weight of 230.47 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-1-ene;piperazine;silane is sourced from PubChem (CID 175359517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).