C18H34N2O4 — CID 175359647
8-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]octanoic acid (PubChem CID 175359647) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is 8-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]octanoic acid.
| Compound Name | 8-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]octanoic acid |
|---|---|
| PubChem CID | 175359647 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 8-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]octanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(CCCCCCCC(=O)O)C1 |
| InChI | InChI=1S/C18H34N2O4/c1-18(2,3)24-17(23)19-15-10-9-13-20(14-15)12-8-6-4-5-7-11-16(21)22/h15H,4-14H2,1-3H3,(H,19,23)(H,21,22)/t15-/m1/s1 |
| InChIKey | JSCMXDLSRYPDSO-OAHLLOKOSA-N |
| XLogP | 3.40 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|