C8H3F13O — CID 175359702
3-(1,2-difluoroethoxy)-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene (PubChem CID 175359702) has the molecular formula C8H3F13O and a molecular weight of 362.09 g/mol. Its IUPAC name is 3-(1,2-difluoroethoxy)-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 3-(1,2-difluoroethoxy)-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 175359702 |
| Molecular Formula | C8H3F13O |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 3-(1,2-difluoroethoxy)-1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-ene |
| SMILES | FCC(F)OC(=C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F13O/c9-1-2(10)22-4(5(11,12)8(19,20)21)3(6(13,14)15)7(16,17)18/h2H,1H2 |
| InChIKey | JPZXJAUVBDYDDV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|