About 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate
2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate (PubChem CID 175359865) has the molecular formula C12H13N3O3
and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate.
Molecular Properties
| Compound Name | 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate |
| PubChem CID | 175359865 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate |
| SMILES | O=COCCc1nc(C(O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C12H13N3O3/c16-8-18-7-6-10-13-12(15-14-10)11(17)9-4-2-1-3-5-9/h1-5,8,11,17H,6-7H2,(H,13,14,15) |
| InChIKey | QOQXSYWMTMWUPK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate?
The IUPAC name of 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate (CID 175359865) is 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate.
What is the SMILES notation for 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate?
The canonical SMILES for 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate is O=COCCc1nc(C(O)c2ccccc2)n[nH]1.
What is the InChIKey of 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate?
The InChIKey is QOQXSYWMTMWUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3/c16-8-18-7-6-10-13-12(15-14-10)11(17)9-4-2-1-3-5-9/h1-5,8,11,17H,6-7H2,(H,13,14,15).
What are the key properties of 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate?
2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate has a molecular weight of 247.25 g/mol, XLogP of 0.60, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[hydroxy(phenyl)methyl]-1H-1,2,4-triazol-5-yl]ethyl formate is sourced from PubChem (CID 175359865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).