About sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate
sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 175360315) has the molecular formula C7H10NNaO4S
and a molecular weight of 227.22 g/mol. Its IUPAC name is sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate.
Molecular Properties
| Compound Name | sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate |
| PubChem CID | 175360315 |
| Molecular Formula | C7H10NNaO4S |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CC1(S(=O)(=O)[O-])C=CC=C(N)C1O.[Na+] |
| InChI | InChI=1S/C7H11NO4S.Na/c1-7(13(10,11)12)4-2-3-5(8)6(7)9;/h2-4,6,9H,8H2,1H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | JVHOWRDTIAQPEL-UHFFFAOYSA-M |
| XLogP | -3.93 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate?
The IUPAC name of sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate (CID 175360315) is sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate.
What is the SMILES notation for sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate?
The canonical SMILES for sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate is CC1(S(=O)(=O)[O-])C=CC=C(N)C1O.[Na+].
What is the InChIKey of sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate?
The InChIKey is JVHOWRDTIAQPEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H11NO4S.Na/c1-7(13(10,11)12)4-2-3-5(8)6(7)9;/h2-4,6,9H,8H2,1H3,(H,10,11,12);/q;+1/p-1.
What are the key properties of sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate?
sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate has a molecular weight of 227.22 g/mol, XLogP of -3.93, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-amino-6-hydroxy-1-methylcyclohexa-2,4-diene-1-sulfonate is sourced from PubChem (CID 175360315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).