C24H19Cl3F2N4O5S — CID 175360675
(2S,3S,4R,5S,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-4-(3,4-dichlorophenyl)-2-(hydroxymethyl)-5-(1,3-oxazol-4-ylmethoxy)-6-sulfanyloxan-3-ol (PubChem CID 175360675) has the molecular formula C24H19Cl3F2N4O5S and a molecular weight of 619.86 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-4-(3,4-dichlorophenyl)-2-(hydroxymethyl)-5-(1,3-oxazol-4-ylmethoxy)-6-sulfanyloxan-3-ol.
| Compound Name | (2S,3S,4R,5S,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-4-(3,4-dichlorophenyl)-2-(hydroxymethyl)-5-(1,3-oxazol-4-ylmethoxy)-6-sulfanyloxan-3-ol |
|---|---|
| PubChem CID | 175360675 |
| Molecular Formula | C24H19Cl3F2N4O5S |
| Molecular Weight | 619.86 g/mol |
| Exact Mass | 618.01 |
| IUPAC Name | (2S,3S,4R,5S,6S)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-4-(3,4-dichlorophenyl)-2-(hydroxymethyl)-5-(1,3-oxazol-4-ylmethoxy)-6-sulfanyloxan-3-ol |
| SMILES | OC[C@@H]1O[C@@H](S)[C@@H](OCc2cocn2)[C@](c2ccc(Cl)c(Cl)c2)(n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@@H]1O |
| InChI | InChI=1S/C24H19Cl3F2N4O5S/c25-14-2-1-12(5-15(14)26)24(33-6-18(31-32-33)11-3-16(28)20(27)17(29)4-11)21(35)19(7-34)38-23(39)22(24)37-9-13-8-36-10-30-13/h1-6,8,10,19,21-23,34-35,39H,7,9H2/t19-,21+,22+,23-,24+/m0/s1 |
| InChIKey | HRIDMWSKBFVDHK-HCSYDALLSA-N |
| XLogP | 4.51 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|