C13H15F3N6O2 — CID 175361111
4-(2-aminopropylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 175361111) has the molecular formula C13H15F3N6O2 and a molecular weight of 344.30 g/mol. Its IUPAC name is 4-(2-aminopropylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(2-aminopropylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 175361111 |
| Molecular Formula | C13H15F3N6O2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-(2-aminopropylamino)-N-hydroxy-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(N)CNc1nonc1/C(=N/c1ccc(C(F)(F)F)cc1)NO |
| InChI | InChI=1S/C13H15F3N6O2/c1-7(17)6-18-11-10(21-24-22-11)12(20-23)19-9-4-2-8(3-5-9)13(14,15)16/h2-5,7,23H,6,17H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | ACJAUJXWIYFQPM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|