About 3-prop-2-enyl-1,3-oxazolidin-2-one;silane
3-prop-2-enyl-1,3-oxazolidin-2-one;silane (PubChem CID 175362572) has the molecular formula C6H13NO2Si
and a molecular weight of 159.26 g/mol. Its IUPAC name is 3-prop-2-enyl-1,3-oxazolidin-2-one;silane.
Molecular Properties
| Compound Name | 3-prop-2-enyl-1,3-oxazolidin-2-one;silane |
| PubChem CID | 175362572 |
| Molecular Formula | C6H13NO2Si |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 3-prop-2-enyl-1,3-oxazolidin-2-one;silane |
| SMILES | C=CCN1CCOC1=O.[SiH4] |
| InChI | InChI=1S/C6H9NO2.H4Si/c1-2-3-7-4-5-9-6(7)8;/h2H,1,3-5H2;1H4 |
| InChIKey | NMHIMXBXSPWBQZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enyl-1,3-oxazolidin-2-one;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enyl-1,3-oxazolidin-2-one;silane?
The IUPAC name of 3-prop-2-enyl-1,3-oxazolidin-2-one;silane (CID 175362572) is 3-prop-2-enyl-1,3-oxazolidin-2-one;silane.
What is the SMILES notation for 3-prop-2-enyl-1,3-oxazolidin-2-one;silane?
The canonical SMILES for 3-prop-2-enyl-1,3-oxazolidin-2-one;silane is C=CCN1CCOC1=O.[SiH4].
What is the InChIKey of 3-prop-2-enyl-1,3-oxazolidin-2-one;silane?
The InChIKey is NMHIMXBXSPWBQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.H4Si/c1-2-3-7-4-5-9-6(7)8;/h2H,1,3-5H2;1H4.
What are the key properties of 3-prop-2-enyl-1,3-oxazolidin-2-one;silane?
3-prop-2-enyl-1,3-oxazolidin-2-one;silane has a molecular weight of 159.26 g/mol, XLogP of -0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enyl-1,3-oxazolidin-2-one;silane is sourced from PubChem (CID 175362572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).