About chromen-4-one;1,3-thiazole
chromen-4-one;1,3-thiazole (PubChem CID 175363331) has the molecular formula C12H9NO2S
and a molecular weight of 231.28 g/mol. Its IUPAC name is chromen-4-one;1,3-thiazole.
Molecular Properties
| Compound Name | chromen-4-one;1,3-thiazole |
| PubChem CID | 175363331 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | chromen-4-one;1,3-thiazole |
| SMILES | O=c1ccoc2ccccc12.c1cscn1 |
| InChI | InChI=1S/C9H6O2.C3H3NS/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2-5-3-4-1/h1-6H;1-3H |
| InChIKey | ZAGBUBBMUXWDNV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chromen-4-one;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-4-one;1,3-thiazole?
The IUPAC name of chromen-4-one;1,3-thiazole (CID 175363331) is chromen-4-one;1,3-thiazole.
What is the SMILES notation for chromen-4-one;1,3-thiazole?
The canonical SMILES for chromen-4-one;1,3-thiazole is O=c1ccoc2ccccc12.c1cscn1.
What is the InChIKey of chromen-4-one;1,3-thiazole?
The InChIKey is ZAGBUBBMUXWDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C3H3NS/c10-8-5-6-11-9-4-2-1-3-7(8)9;1-2-5-3-4-1/h1-6H;1-3H.
What are the key properties of chromen-4-one;1,3-thiazole?
chromen-4-one;1,3-thiazole has a molecular weight of 231.28 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-4-one;1,3-thiazole is sourced from PubChem (CID 175363331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).