C10H16O — CID 175364
8-Oxabicyclo[3.2.1]octane, 6-(1-methylethenyl)- (PubChem CID 175364) has the molecular formula C10H16O and a molecular weight of 152.23 g/mol. Its IUPAC name is 6-prop-1-en-2-yl-8-oxabicyclo[3.2.1]octane.
| Compound Name | 8-Oxabicyclo[3.2.1]octane, 6-(1-methylethenyl)- |
|---|---|
| PubChem CID | 175364 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.23 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 6-prop-1-en-2-yl-8-oxabicyclo[3.2.1]octane |
| SMILES | CC(=C)C1CC2CCCC1O2 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-6-8-4-3-5-10(9)11-8/h8-10H,1,3-6H2,2H3 |
| InChIKey | HSVRBYQDQWOTEJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 9.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 174 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|