C18H21N5O3 — CID 175364082
4-(6-acetamido-4-aminopyrimido[4,5-b]indol-9-yl)-3,3-dimethylbutanoic acid (PubChem CID 175364082) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 4-(6-acetamido-4-aminopyrimido[4,5-b]indol-9-yl)-3,3-dimethylbutanoic acid.
| Compound Name | 4-(6-acetamido-4-aminopyrimido[4,5-b]indol-9-yl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 175364082 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 4-(6-acetamido-4-aminopyrimido[4,5-b]indol-9-yl)-3,3-dimethylbutanoic acid |
| SMILES | CC(=O)Nc1ccc2c(c1)c1c(N)ncnc1n2CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C18H21N5O3/c1-10(24)22-11-4-5-13-12(6-11)15-16(19)20-9-21-17(15)23(13)8-18(2,3)7-14(25)26/h4-6,9H,7-8H2,1-3H3,(H,22,24)(H,25,26)(H2,19,20,21) |
| InChIKey | VJWOEXHQGAPAHD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |