About 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one
6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one (PubChem CID 175364109) has the molecular formula C20H22ClN3O2S
and a molecular weight of 403.94 g/mol. Its IUPAC name is 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one.
Molecular Properties
| Compound Name | 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one |
| PubChem CID | 175364109 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)NSN3CCN2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-14-2-4-16(18(21)12-14)15-3-5-19-17(13-15)20(25)22-27-24(19)7-6-23-8-10-26-11-9-23/h2-5,12-13H,6-11H2,1H3,(H,22,25) |
| InChIKey | ILEBHBGQECTITA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one?
The IUPAC name of 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one (CID 175364109) is 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one.
What is the SMILES notation for 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one?
The canonical SMILES for 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one is Cc1ccc(-c2ccc3c(c2)C(=O)NSN3CCN2CCOCC2)c(Cl)c1.
What is the InChIKey of 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one?
The InChIKey is ILEBHBGQECTITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN3O2S/c1-14-2-4-16(18(21)12-14)15-3-5-19-17(13-15)20(25)22-27-24(19)7-6-23-8-10-26-11-9-23/h2-5,12-13H,6-11H2,1H3,(H,22,25).
What are the key properties of 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one?
6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one has a molecular weight of 403.94 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloro-4-methylphenyl)-1-(2-morpholin-4-ylethyl)-2,1,3-benzothiadiazin-4-one is sourced from PubChem (CID 175364109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).