About potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride
potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride (PubChem CID 175366173) has the molecular formula C15H11Cl2KN2O2
and a molecular weight of 361.27 g/mol. Its IUPAC name is potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride.
Molecular Properties
| Compound Name | potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride |
| PubChem CID | 175366173 |
| Molecular Formula | C15H11Cl2KN2O2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride |
| SMILES | O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O.[H-].[K+] |
| InChI | InChI=1S/C15H10Cl2N2O2.K.H/c16-8-5-6-12-10(7-8)13(19-15(21)14(20)18-12)9-3-1-2-4-11(9)17;;/h1-7,15,21H,(H,18,20);;/q;+1;-1 |
| InChIKey | JYIVDQACHZTNNB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride?
The IUPAC name of potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride (CID 175366173) is potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride.
What is the SMILES notation for potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride?
The canonical SMILES for potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride is O=C1Nc2ccc(Cl)cc2C(c2ccccc2Cl)=NC1O.[H-].[K+].
What is the InChIKey of potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride?
The InChIKey is JYIVDQACHZTNNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2N2O2.K.H/c16-8-5-6-12-10(7-8)13(19-15(21)14(20)18-12)9-3-1-2-4-11(9)17;;/h1-7,15,21H,(H,18,20);;/q;+1;-1.
What are the key properties of potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride?
potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride has a molecular weight of 361.27 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one;hydride is sourced from PubChem (CID 175366173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).