C11H23N3O6 — CID 175366661
ethyl carbamate;4-pentyl-1,3-dioxetan-2-one;urea (PubChem CID 175366661) has the molecular formula C11H23N3O6 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl carbamate;4-pentyl-1,3-dioxetan-2-one;urea.
| Compound Name | ethyl carbamate;4-pentyl-1,3-dioxetan-2-one;urea |
|---|---|
| PubChem CID | 175366661 |
| Molecular Formula | C11H23N3O6 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl carbamate;4-pentyl-1,3-dioxetan-2-one;urea |
| SMILES | CCCCCC1OC(=O)O1.CCOC(N)=O.NC(N)=O |
| InChI | InChI=1S/C7H12O3.C3H7NO2.CH4N2O/c1-2-3-4-5-6-9-7(8)10-6;1-2-6-3(4)5;2-1(3)4/h6H,2-5H2,1H3;2H2,1H3,(H2,4,5);(H4,2,3,4) |
| InChIKey | VTKXRIIUDFGOMZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 156.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|