C15H27F3N4O7 — CID 175367103
2,2-bis(butanoylamino)butanoic acid;2,2,2-trifluoroacetic acid;urea (PubChem CID 175367103) has the molecular formula C15H27F3N4O7 and a molecular weight of 432.40 g/mol. Its IUPAC name is 2,2-bis(butanoylamino)butanoic acid;2,2,2-trifluoroacetic acid;urea.
| Compound Name | 2,2-bis(butanoylamino)butanoic acid;2,2,2-trifluoroacetic acid;urea |
|---|---|
| PubChem CID | 175367103 |
| Molecular Formula | C15H27F3N4O7 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2,2-bis(butanoylamino)butanoic acid;2,2,2-trifluoroacetic acid;urea |
| SMILES | CCCC(=O)NC(CC)(NC(=O)CCC)C(=O)O.NC(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H22N2O4.C2HF3O2.CH4N2O/c1-4-7-9(15)13-12(6-3,11(17)18)14-10(16)8-5-2;3-2(4,5)1(6)7;2-1(3)4/h4-8H2,1-3H3,(H,13,15)(H,14,16)(H,17,18);(H,6,7);(H4,2,3,4) |
| InChIKey | SNBMRGUIMZAKSO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 201.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|