C6H9N3S3 — CID 175367422
1-propyl-1,3,5-triazinane-2,4,6-trithione (PubChem CID 175367422) has the molecular formula C6H9N3S3 and a molecular weight of 219.36 g/mol. Its IUPAC name is 1-propyl-1,3,5-triazinane-2,4,6-trithione.
| Compound Name | 1-propyl-1,3,5-triazinane-2,4,6-trithione |
|---|---|
| PubChem CID | 175367422 |
| Molecular Formula | C6H9N3S3 |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 1-propyl-1,3,5-triazinane-2,4,6-trithione |
| SMILES | CCCn1c(=S)[nH]c(=S)[nH]c1=S |
| InChI | InChI=1S/C6H9N3S3/c1-2-3-9-5(11)7-4(10)8-6(9)12/h2-3H2,1H3,(H2,7,8,10,11,12) |
| InChIKey | FVPWNVWUHFHDEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 36.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|