C23H31F2N3O4S — CID 175368667
tert-butyl-[[1-(5-cyclopropyl-2-fluorophenyl)-2-fluoro-3-(2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl)propyl]amino]-oxidosulfanium (PubChem CID 175368667) has the molecular formula C23H31F2N3O4S and a molecular weight of 483.58 g/mol. Its IUPAC name is tert-butyl-[[1-(5-cyclopropyl-2-fluorophenyl)-2-fluoro-3-(2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl)propyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-(5-cyclopropyl-2-fluorophenyl)-2-fluoro-3-(2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl)propyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175368667 |
| Molecular Formula | C23H31F2N3O4S |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | tert-butyl-[[1-(5-cyclopropyl-2-fluorophenyl)-2-fluoro-3-(2,4,6-trioxo-1-propan-2-yl-1,3-diazinan-5-yl)propyl]amino]-oxidosulfanium |
| SMILES | CC(C)N1C(=O)NC(=O)C(CC(F)C(N[S+]([O-])C(C)(C)C)c2cc(C3CC3)ccc2F)C1=O |
| InChI | InChI=1S/C23H31F2N3O4S/c1-12(2)28-21(30)16(20(29)26-22(28)31)11-18(25)19(27-33(32)23(3,4)5)15-10-14(13-6-7-13)8-9-17(15)24/h8-10,12-13,16,18-19,27H,6-7,11H2,1-5H3,(H,26,29,31) |
| InChIKey | CYZGVHSMJHXHCD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|