C12HF21O — CID 175369020
3,3,4,4,5,5,6,6-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)cyclohexene (PubChem CID 175369020) has the molecular formula C12HF21O and a molecular weight of 560.10 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)cyclohexene.
| Compound Name | 3,3,4,4,5,5,6,6-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)cyclohexene |
|---|---|
| PubChem CID | 175369020 |
| Molecular Formula | C12HF21O |
| Molecular Weight | 560.10 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)cyclohexene |
| SMILES | FC(F)C(F)(OC1=C(C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C12HF21O/c13-3(14)7(20,12(31,32)33)34-2-1(4(15,10(25,26)27)11(28,29)30)5(16,17)8(21,22)9(23,24)6(2,18)19/h3H |
| InChIKey | VTZIGHSIFKCRDT-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.10 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|