C32H45N5O4 — CID 175369420
[3-[7-hydroxy-6-[6-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]naphthalen-2-yl]oxypropylamino] 2,2-dimethylpropanoate (PubChem CID 175369420) has the molecular formula C32H45N5O4 and a molecular weight of 563.74 g/mol. Its IUPAC name is [3-[7-hydroxy-6-[6-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]naphthalen-2-yl]oxypropylamino] 2,2-dimethylpropanoate.
| Compound Name | [3-[7-hydroxy-6-[6-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]naphthalen-2-yl]oxypropylamino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175369420 |
| Molecular Formula | C32H45N5O4 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | [3-[7-hydroxy-6-[6-[methyl-(1,2,2,3-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]naphthalen-2-yl]oxypropylamino] 2,2-dimethylpropanoate |
| SMILES | CC1C(N(C)c2ccc(-c3cc4ccc(OCCCNOC(=O)C(C)(C)C)cc4cc3O)nn2)CCN(C)C1(C)C |
| InChI | InChI=1S/C32H45N5O4/c1-21-27(14-16-36(7)32(21,5)6)37(8)29-13-12-26(34-35-29)25-19-22-10-11-24(18-23(22)20-28(25)38)40-17-9-15-33-41-30(39)31(2,3)4/h10-13,18-21,27,33,38H,9,14-17H2,1-8H3 |
| InChIKey | JXYUMHGKKHMOAO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|