C27H24ClN5O — CID 175369893
N-(4-chlorophenyl)-3-[2-[2-(ethylamino)-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-4-methylbenzamide (PubChem CID 175369893) has the molecular formula C27H24ClN5O and a molecular weight of 469.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[2-[2-(ethylamino)-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-4-methylbenzamide.
| Compound Name | N-(4-chlorophenyl)-3-[2-[2-(ethylamino)-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 175369893 |
| Molecular Formula | C27H24ClN5O |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-(4-chlorophenyl)-3-[2-[2-(ethylamino)-5-(1-methylpyrazol-4-yl)-3-pyridinyl]ethynyl]-4-methylbenzamide |
| SMILES | CCNc1ncc(-c2cnn(C)c2)cc1C#Cc1cc(C(=O)Nc2ccc(Cl)cc2)ccc1C |
| InChI | InChI=1S/C27H24ClN5O/c1-4-29-26-20(14-22(15-30-26)23-16-31-33(3)17-23)8-7-19-13-21(6-5-18(19)2)27(34)32-25-11-9-24(28)10-12-25/h5-6,9-17H,4H2,1-3H3,(H,29,30)(H,32,34) |
| InChIKey | QPGRDSSZURIOBM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|