About ethyl 2-(dibutylamino)acetate
ethyl 2-(dibutylamino)acetate (PubChem CID 17537) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is ethyl 2-(dibutylamino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(dibutylamino)acetate |
| PubChem CID | 17537 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethyl 2-(dibutylamino)acetate |
| SMILES | CCCCN(CCCC)CC(=O)OCC |
| InChI | InChI=1S/C12H25NO2/c1-4-7-9-13(10-8-5-2)11-12(14)15-6-3/h4-11H2,1-3H3 |
| InChIKey | OMKBLDWHKBELJV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(dibutylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(dibutylamino)acetate?
The IUPAC name of ethyl 2-(dibutylamino)acetate (CID 17537) is ethyl 2-(dibutylamino)acetate.
What is the SMILES notation for ethyl 2-(dibutylamino)acetate?
The canonical SMILES for ethyl 2-(dibutylamino)acetate is CCCCN(CCCC)CC(=O)OCC.
What is the InChIKey of ethyl 2-(dibutylamino)acetate?
The InChIKey is OMKBLDWHKBELJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-4-7-9-13(10-8-5-2)11-12(14)15-6-3/h4-11H2,1-3H3.
What are the key properties of ethyl 2-(dibutylamino)acetate?
ethyl 2-(dibutylamino)acetate has a molecular weight of 215.34 g/mol, XLogP of 2.45, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(dibutylamino)acetate is sourced from PubChem (CID 17537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).