About (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione (PubChem CID 175370449) has the molecular formula C11H20N6O4
and a molecular weight of 300.32 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione |
| PubChem CID | 175370449 |
| Molecular Formula | C11H20N6O4 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione |
| SMILES | Cn1ccc(=O)[nH]c1=O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C5H6N2O2/c7-4(5(11)12)2-1-3-10-6(8)9;1-7-3-2-4(8)6-5(7)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-3H,1H3,(H,6,8,9)/t4-;/m0./s1 |
| InChIKey | ZRZDMDPGGHQSMT-WCCKRBBISA-N |
| XLogP | -2.47 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione?
The IUPAC name of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione (CID 175370449) is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione.
What is the SMILES notation for (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione?
The canonical SMILES for (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione is Cn1ccc(=O)[nH]c1=O.NC(N)=NCCC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione?
The InChIKey is ZRZDMDPGGHQSMT-WCCKRBBISA-N. The full InChI is InChI=1S/C6H14N4O2.C5H6N2O2/c7-4(5(11)12)2-1-3-10-6(8)9;1-7-3-2-4(8)6-5(7)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);2-3H,1H3,(H,6,8,9)/t4-;/m0./s1.
What are the key properties of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione?
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione has a molecular weight of 300.32 g/mol, XLogP of -2.47, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;1-methylpyrimidine-2,4-dione is sourced from PubChem (CID 175370449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).