C10H11N3 — CID 175370530
1-(1-ethenylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole (PubChem CID 175370530) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 1-(1-ethenylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole.
| Compound Name | 1-(1-ethenylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 175370530 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 1-(1-ethenylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole |
| SMILES | C=CC1(n2cncn2)C=CC=CC1 |
| InChI | InChI=1S/C10H11N3/c1-2-10(6-4-3-5-7-10)13-9-11-8-12-13/h2-6,8-9H,1,7H2 |
| InChIKey | SCTYZQPGYSUSND-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|