About 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride
3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride (PubChem CID 175370626) has the molecular formula C7H15ClN2
and a molecular weight of 162.66 g/mol. Its IUPAC name is 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride.
Molecular Properties
| Compound Name | 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride |
| PubChem CID | 175370626 |
| Molecular Formula | C7H15ClN2 |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride |
| SMILES | CCC[NH+]1C=CN(C)C1.[Cl-] |
| InChI | InChI=1S/C7H14N2.ClH/c1-3-4-9-6-5-8(2)7-9;/h5-6H,3-4,7H2,1-2H3;1H |
| InChIKey | GYTJXQRCNBRFGU-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride?
The IUPAC name of 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride (CID 175370626) is 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride.
What is the SMILES notation for 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride?
The canonical SMILES for 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride is CCC[NH+]1C=CN(C)C1.[Cl-].
What is the InChIKey of 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride?
The InChIKey is GYTJXQRCNBRFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.ClH/c1-3-4-9-6-5-8(2)7-9;/h5-6H,3-4,7H2,1-2H3;1H.
What are the key properties of 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride?
3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride has a molecular weight of 162.66 g/mol, XLogP of -3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-propyl-1,2-dihydroimidazol-1-ium chloride is sourced from PubChem (CID 175370626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).