C17H29NO4 — CID 175370662
tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 175370662) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 175370662 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1OC(C)(C2=CCN(C(=O)OC(C)(C)C)CC2)OC1(C)C |
| InChI | InChI=1S/C17H29NO4/c1-12-16(5,6)22-17(7,20-12)13-8-10-18(11-9-13)14(19)21-15(2,3)4/h8,12H,9-11H2,1-7H3 |
| InChIKey | CLWJIEMLLGCVCT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|