About tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide
tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide (PubChem CID 175370772) has the molecular formula C9H17BrN2O2S
and a molecular weight of 297.22 g/mol. Its IUPAC name is tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide.
Molecular Properties
| Compound Name | tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide |
| PubChem CID | 175370772 |
| Molecular Formula | C9H17BrN2O2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide |
| SMILES | Br.CC(C)(C)OC(=O)C(S)N1C=NCC1 |
| InChI | InChI=1S/C9H16N2O2S.BrH/c1-9(2,3)13-8(12)7(14)11-5-4-10-6-11;/h6-7,14H,4-5H2,1-3H3;1H |
| InChIKey | MJUPVGKFEFMIOS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide?
The IUPAC name of tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide (CID 175370772) is tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide.
What is the SMILES notation for tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide?
The canonical SMILES for tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide is Br.CC(C)(C)OC(=O)C(S)N1C=NCC1.
What is the InChIKey of tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide?
The InChIKey is MJUPVGKFEFMIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2S.BrH/c1-9(2,3)13-8(12)7(14)11-5-4-10-6-11;/h6-7,14H,4-5H2,1-3H3;1H.
What are the key properties of tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide?
tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide has a molecular weight of 297.22 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4,5-dihydroimidazol-1-yl)-2-sulfanylacetate;hydrobromide is sourced from PubChem (CID 175370772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).