C23H26O5S — CID 175370865
2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]-4-methylbenzenesulfonic acid (PubChem CID 175370865) has the molecular formula C23H26O5S and a molecular weight of 414.52 g/mol. Its IUPAC name is 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175370865 |
| Molecular Formula | C23H26O5S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl]-4-methylbenzenesulfonic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(-c2cc(C)ccc2S(=O)(=O)O)cc1O |
| InChI | InChI=1S/C23H26O5S/c1-13(2)17-7-5-14(3)10-19(17)23-20(24)11-16(12-21(23)25)18-9-15(4)6-8-22(18)29(26,27)28/h6,8-12,17,19,24-25H,1,5,7H2,2-4H3,(H,26,27,28)/t17-,19+/m0/s1 |
| InChIKey | QFVGLEVVNZTWIU-PKOBYXMFSA-N |
| XLogP | 5.34 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|