About 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid
2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid (PubChem CID 175371599) has the molecular formula C15H28O5Si2
and a molecular weight of 344.56 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid |
| PubChem CID | 175371599 |
| Molecular Formula | C15H28O5Si2 |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid |
| SMILES | CCC(c1ccccc1)C1CCC[Si](C)(C)O1.O[Si](O)(O)O |
| InChI | InChI=1S/C15H24OSi.H4O4Si/c1-4-14(13-9-6-5-7-10-13)15-11-8-12-17(2,3)16-15;1-5(2,3)4/h5-7,9-10,14-15H,4,8,11-12H2,1-3H3;1-4H |
| InChIKey | DSMAAEYKWHJUBV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid?
The IUPAC name of 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid (CID 175371599) is 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid.
What is the SMILES notation for 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid?
The canonical SMILES for 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid is CCC(c1ccccc1)C1CCC[Si](C)(C)O1.O[Si](O)(O)O.
What is the InChIKey of 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid?
The InChIKey is DSMAAEYKWHJUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24OSi.H4O4Si/c1-4-14(13-9-6-5-7-10-13)15-11-8-12-17(2,3)16-15;1-5(2,3)4/h5-7,9-10,14-15H,4,8,11-12H2,1-3H3;1-4H.
What are the key properties of 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid?
2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid has a molecular weight of 344.56 g/mol, XLogP of 1.96, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(1-phenylpropyl)oxasilinane;silicic acid is sourced from PubChem (CID 175371599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).