C46H52N8O5S — CID 175371754
3-[7-[11-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-11-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 175371754) has the molecular formula C46H52N8O5S and a molecular weight of 829.04 g/mol. Its IUPAC name is 3-[7-[11-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-11-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[11-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-11-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175371754 |
| Molecular Formula | C46H52N8O5S |
| Molecular Weight | 829.04 g/mol |
| Exact Mass | 828.38 |
| IUPAC Name | 3-[7-[11-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-11-oxoundecyl]sulfanyl-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCCN(C(=O)CCCCCCCCCCSc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C46H52N8O5S/c47-43-41-42(31-20-22-34(23-21-31)59-33-15-8-7-9-16-33)51-54(44(41)49-30-48-43)32-14-13-26-52(28-32)40(56)19-10-5-3-1-2-4-6-11-27-60-38-18-12-17-35-36(38)29-53(46(35)58)37-24-25-39(55)50-45(37)57/h7-9,12,15-18,20-23,30,32,37H,1-6,10-11,13-14,19,24-29H2,(H2,47,48,49)(H,50,55,57) |
| InChIKey | QAXYWKULHDYTPC-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.04 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|