C50H27F5N4 — CID 175371887
2-(2,3,4,5,6-pentafluorophenyl)-3,5,7,8-tetraphenylporphyrin (PubChem CID 175371887) has the molecular formula C50H27F5N4 and a molecular weight of 778.78 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-3,5,7,8-tetraphenylporphyrin.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-3,5,7,8-tetraphenylporphyrin |
|---|---|
| PubChem CID | 175371887 |
| Molecular Formula | C50H27F5N4 |
| Molecular Weight | 778.78 g/mol |
| Exact Mass | 778.22 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-3,5,7,8-tetraphenylporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=C(c3ccccc3)/C3=C(\c4ccccc4)C4=N/C(=C\C5=N/C(=C\C6=N/C(=C\C2=N3)C=C6)C=C5)C(c2ccccc2)=C4c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C50H27F5N4/c51-44-43(45(52)47(54)48(55)46(44)53)42-37-27-35-24-22-33(57-35)25-32-21-23-34(56-32)26-36-38(28-13-5-1-6-14-28)39(29-15-7-2-8-16-29)49(58-36)41(31-19-11-4-12-20-31)50(59-37)40(42)30-17-9-3-10-18-30/h1-27H/b32-25-,33-25-,34-26-,35-27-,36-26-,37-27-,49-41-,50-41- |
| InChIKey | VESMUIQPHOPRNQ-BQHUIEIOSA-N |
| XLogP | 11.91 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.78 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|