About azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride
azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride (PubChem CID 175371900) has the molecular formula C10H21ClN2O2
and a molecular weight of 236.74 g/mol. Its IUPAC name is azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride |
| PubChem CID | 175371900 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride |
| SMILES | C=C(CCNCC=C(C)C)C(=O)O.Cl.N |
| InChI | InChI=1S/C10H17NO2.ClH.H3N/c1-8(2)4-6-11-7-5-9(3)10(12)13;;/h4,11H,3,5-7H2,1-2H3,(H,12,13);1H;1H3 |
| InChIKey | BSVWDQMKZFJJBG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
The IUPAC name of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride (CID 175371900) is azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride.
What is the SMILES notation for azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
The canonical SMILES for azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride is C=C(CCNCC=C(C)C)C(=O)O.Cl.N.
What is the InChIKey of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
The InChIKey is BSVWDQMKZFJJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2.ClH.H3N/c1-8(2)4-6-11-7-5-9(3)10(12)13;;/h4,11H,3,5-7H2,1-2H3,(H,12,13);1H;1H3.
What are the key properties of azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride?
azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride has a molecular weight of 236.74 g/mol, XLogP of 2.16, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(3-methylbut-2-enylamino)-2-methylidenebutanoic acid;hydrochloride is sourced from PubChem (CID 175371900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).