C40H50O9 — CID 175372044
7-hydroxy-1,1,13,13-tetramethyl-14-oxo-14-trityloxytetradecane-1,6,8-tricarboxylic acid (PubChem CID 175372044) has the molecular formula C40H50O9 and a molecular weight of 674.83 g/mol. Its IUPAC name is 7-hydroxy-1,1,13,13-tetramethyl-14-oxo-14-trityloxytetradecane-1,6,8-tricarboxylic acid.
| Compound Name | 7-hydroxy-1,1,13,13-tetramethyl-14-oxo-14-trityloxytetradecane-1,6,8-tricarboxylic acid |
|---|---|
| PubChem CID | 175372044 |
| Molecular Formula | C40H50O9 |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | 7-hydroxy-1,1,13,13-tetramethyl-14-oxo-14-trityloxytetradecane-1,6,8-tricarboxylic acid |
| SMILES | CC(C)(CCCCC(C(=O)O)C(O)C(CCCCC(C)(C)C(=O)OC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C40H50O9/c1-38(2,36(46)47)26-16-14-24-31(34(42)43)33(41)32(35(44)45)25-15-17-27-39(3,4)37(48)49-40(28-18-8-5-9-19-28,29-20-10-6-11-21-29)30-22-12-7-13-23-30/h5-13,18-23,31-33,41H,14-17,24-27H2,1-4H3,(H,42,43)(H,44,45)(H,46,47) |
| InChIKey | USMFSKNCMNPDMA-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|