C18H19N3O — CID 175372198
benzene-1,2-diamine;2-(pyridin-2-ylmethyl)phenol (PubChem CID 175372198) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is benzene-1,2-diamine;2-(pyridin-2-ylmethyl)phenol.
| Compound Name | benzene-1,2-diamine;2-(pyridin-2-ylmethyl)phenol |
|---|---|
| PubChem CID | 175372198 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | benzene-1,2-diamine;2-(pyridin-2-ylmethyl)phenol |
| SMILES | Nc1ccccc1N.Oc1ccccc1Cc1ccccn1 |
| InChI | InChI=1S/C12H11NO.C6H8N2/c14-12-7-2-1-5-10(12)9-11-6-3-4-8-13-11;7-5-3-1-2-4-6(5)8/h1-8,14H,9H2;1-4H,7-8H2 |
| InChIKey | KWMXSZOYJJBILU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|