About 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran
1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran (PubChem CID 175372331) has the molecular formula C20H20F2O
and a molecular weight of 314.38 g/mol. Its IUPAC name is 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran.
Molecular Properties
| Compound Name | 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran |
| PubChem CID | 175372331 |
| Molecular Formula | C20H20F2O |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran |
| SMILES | CCCC1C=CC=CO1.Fc1cc(F)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H8F2.C8H12O/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9;1-2-5-8-6-3-4-7-9-8/h1-8H;3-4,6-8H,2,5H2,1H3 |
| InChIKey | LDPAAFDSEJXOJI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran?
The IUPAC name of 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran (CID 175372331) is 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran.
What is the SMILES notation for 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran?
The canonical SMILES for 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran is CCCC1C=CC=CO1.Fc1cc(F)cc(-c2ccccc2)c1.
What is the InChIKey of 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran?
The InChIKey is LDPAAFDSEJXOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2.C8H12O/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9;1-2-5-8-6-3-4-7-9-8/h1-8H;3-4,6-8H,2,5H2,1H3.
What are the key properties of 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran?
1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran has a molecular weight of 314.38 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-5-phenylbenzene;2-propyl-2H-pyran is sourced from PubChem (CID 175372331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).