C19H19ClN6O4S2 — CID 175372715
5-chloro-3-[(2S,3S,4R,5S,6S)-5-ethoxy-3-hydroxy-2-(hydroxymethyl)-6-sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-4-yl]pyridine-2-carbonitrile (PubChem CID 175372715) has the molecular formula C19H19ClN6O4S2 and a molecular weight of 494.99 g/mol. Its IUPAC name is 5-chloro-3-[(2S,3S,4R,5S,6S)-5-ethoxy-3-hydroxy-2-(hydroxymethyl)-6-sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-4-yl]pyridine-2-carbonitrile.
| Compound Name | 5-chloro-3-[(2S,3S,4R,5S,6S)-5-ethoxy-3-hydroxy-2-(hydroxymethyl)-6-sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 175372715 |
| Molecular Formula | C19H19ClN6O4S2 |
| Molecular Weight | 494.99 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 5-chloro-3-[(2S,3S,4R,5S,6S)-5-ethoxy-3-hydroxy-2-(hydroxymethyl)-6-sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-4-yl]pyridine-2-carbonitrile |
| SMILES | CCO[C@@H]1[C@H](S)O[C@@H](CO)[C@@H](O)[C@@]1(c1cc(Cl)cnc1C#N)n1cc(-c2nccs2)nn1 |
| InChI | InChI=1S/C19H19ClN6O4S2/c1-2-29-16-18(31)30-14(9-27)15(28)19(16,11-5-10(20)7-23-12(11)6-21)26-8-13(24-25-26)17-22-3-4-32-17/h3-5,7-8,14-16,18,27-28,31H,2,9H2,1H3/t14-,15+,16+,18-,19+/m0/s1 |
| InChIKey | FUCYTBDCKFYKQD-AFQPOQBFSA-N |
| XLogP | 1.48 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.99 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|