C24H31N3O6S — CID 175372731
tert-butyl-[[(1R)-1-[2-[(5S)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium (PubChem CID 175372731) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is tert-butyl-[[(1R)-1-[2-[(5S)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1R)-1-[2-[(5S)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175372731 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | tert-butyl-[[(1R)-1-[2-[(5S)-1-(oxan-4-yl)-2,4,6-trioxo-1,3-diazinan-5-yl]-2-oxoethyl]-2,3-dihydroinden-1-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@]1(CC(=O)[C@H]2C(=O)NC(=O)N(C3CCOCC3)C2=O)CCc2ccccc21 |
| InChI | InChI=1S/C24H31N3O6S/c1-23(2,3)34(32)26-24(11-8-15-6-4-5-7-17(15)24)14-18(28)19-20(29)25-22(31)27(21(19)30)16-9-12-33-13-10-16/h4-7,16,19,26H,8-14H2,1-3H3,(H,25,29,31)/t19-,24+,34?/m0/s1 |
| InChIKey | DXUFPSVEUPGDOP-QCOYJYCBSA-N |
| XLogP | 1.71 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|