C24H27BFNO2 — CID 175373036
1-ethyl-6-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-2-amine (PubChem CID 175373036) has the molecular formula C24H27BFNO2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 1-ethyl-6-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-2-amine.
| Compound Name | 1-ethyl-6-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 175373036 |
| Molecular Formula | C24H27BFNO2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-ethyl-6-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]naphthalen-2-amine |
| SMILES | CCc1c(N)ccc2cc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3F)ccc12 |
| InChI | InChI=1S/C24H27BFNO2/c1-6-18-19-10-7-16(13-15(19)8-12-22(18)27)20-11-9-17(14-21(20)26)25-28-23(2,3)24(4,5)29-25/h7-14H,6,27H2,1-5H3 |
| InChIKey | ZDJMHLBFXJFQAJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|