About 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane
1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane (PubChem CID 175373144) has the molecular formula C5H4F6N2S
and a molecular weight of 238.16 g/mol. Its IUPAC name is 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane.
Molecular Properties
| Compound Name | 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane |
| PubChem CID | 175373144 |
| Molecular Formula | C5H4F6N2S |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane |
| SMILES | FC(F)(F)SC(F)(F)F.c1cn[nH]c1 |
| InChI | InChI=1S/C3H4N2.C2F6S/c1-2-4-5-3-1;3-1(4,5)9-2(6,7)8/h1-3H,(H,4,5); |
| InChIKey | ATSQCMNTXYDKIC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane?
The IUPAC name of 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane (CID 175373144) is 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane.
What is the SMILES notation for 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane?
The canonical SMILES for 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane is FC(F)(F)SC(F)(F)F.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane?
The InChIKey is ATSQCMNTXYDKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2F6S/c1-2-4-5-3-1;3-1(4,5)9-2(6,7)8/h1-3H,(H,4,5);.
What are the key properties of 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane?
1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane has a molecular weight of 238.16 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;trifluoro(trifluoromethylsulfanyl)methane is sourced from PubChem (CID 175373144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).