C26H18F7N3O3S — CID 175373589
3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]pyrazole (PubChem CID 175373589) has the molecular formula C26H18F7N3O3S and a molecular weight of 585.50 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]pyrazole.
| Compound Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]pyrazole |
|---|---|
| PubChem CID | 175373589 |
| Molecular Formula | C26H18F7N3O3S |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-[(3R)-1-[2,3,4,5-tetrafluoro-6-(trifluoromethyl)phenyl]sulfonylpyrrolidin-3-yl]pyrazole |
| SMILES | O=S(=O)(c1c(F)c(F)c(F)c(F)c1C(F)(F)F)N1CC[C@@H](n2ccc(-c3ccc(Oc4ccccc4)cc3)n2)C1 |
| InChI | InChI=1S/C26H18F7N3O3S/c27-21-20(26(31,32)33)25(24(30)23(29)22(21)28)40(37,38)35-12-10-16(14-35)36-13-11-19(34-36)15-6-8-18(9-7-15)39-17-4-2-1-3-5-17/h1-9,11,13,16H,10,12,14H2/t16-/m1/s1 |
| InChIKey | WEKGWLCKRQBZHU-MRXNPFEDSA-N |
| XLogP | 6.55 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|